C26H24O3 — CID 11596131
(E)-4-[(4S,6S)-2,6-diphenyl-1,3-dioxan-4-yl]-1-phenylbut-2-en-1-one (PubChem CID 11596131) has the molecular formula C26H24O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is (E)-4-[(4S,6S)-2,6-diphenyl-1,3-dioxan-4-yl]-1-phenylbut-2-en-1-one.
| Compound Name | (E)-4-[(4S,6S)-2,6-diphenyl-1,3-dioxan-4-yl]-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 11596131 |
| Molecular Formula | C26H24O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (E)-4-[(4S,6S)-2,6-diphenyl-1,3-dioxan-4-yl]-1-phenylbut-2-en-1-one |
| SMILES | O=C(/C=C/C[C@H]1C[C@@H](c2ccccc2)OC(c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C26H24O3/c27-24(20-11-4-1-5-12-20)18-10-17-23-19-25(21-13-6-2-7-14-21)29-26(28-23)22-15-8-3-9-16-22/h1-16,18,23,25-26H,17,19H2/b18-10+/t23-,25-,26?/m0/s1 |
| InChIKey | ZCJXDEIWIIFCHH-MZNOONQGSA-N |
| XLogP | 6.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|