C26H34N2O6 — CID 23654039
N'-hydroxy-N-[4-[6-(methoxymethyl)-2-phenyl-1,3-dioxan-4-yl]phenyl]octanediamide (PubChem CID 23654039) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[6-(methoxymethyl)-2-phenyl-1,3-dioxan-4-yl]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[4-[6-(methoxymethyl)-2-phenyl-1,3-dioxan-4-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 23654039 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | N'-hydroxy-N-[4-[6-(methoxymethyl)-2-phenyl-1,3-dioxan-4-yl]phenyl]octanediamide |
| SMILES | COCC1CC(c2ccc(NC(=O)CCCCCCC(=O)NO)cc2)OC(c2ccccc2)O1 |
| InChI | InChI=1S/C26H34N2O6/c1-32-18-22-17-23(34-26(33-22)20-9-5-4-6-10-20)19-13-15-21(16-14-19)27-24(29)11-7-2-3-8-12-25(30)28-31/h4-6,9-10,13-16,22-23,26,31H,2-3,7-8,11-12,17-18H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | LYUVXGJPBQUTFH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|