C33H41N3O6 — CID 4662833
N-[4-[4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide (PubChem CID 4662833) has the molecular formula C33H41N3O6 and a molecular weight of 575.71 g/mol. Its IUPAC name is N-[4-[4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[4-[4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 4662833 |
| Molecular Formula | C33H41N3O6 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | N-[4-[4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide |
| SMILES | CN(Cc1ccccc1)CC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)CCCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C33H41N3O6/c1-36(21-24-8-4-2-5-9-24)22-29-20-30(26-14-12-25(23-37)13-15-26)42-33(41-29)27-16-18-28(19-17-27)34-31(38)10-6-3-7-11-32(39)35-40/h2,4-5,8-9,12-19,29-30,33,37,40H,3,6-7,10-11,20-23H2,1H3,(H,34,38)(H,35,39) |
| InChIKey | XYXFNVSANAAWFV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|