C34H43N3O7 — CID 3887668
N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 3887668) has the molecular formula C34H43N3O7 and a molecular weight of 605.73 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 3887668 |
| Molecular Formula | C34H43N3O7 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | CC(C(O)c1ccccc1)N(C)CC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)CCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C34H43N3O7/c1-23(33(41)26-8-4-3-5-9-26)37(2)21-29-20-30(25-14-12-24(22-38)13-15-25)44-34(43-29)27-16-18-28(19-17-27)35-31(39)10-6-7-11-32(40)36-42/h3-5,8-9,12-19,23,29-30,33-34,38,41-42H,6-7,10-11,20-22H2,1-2H3,(H,35,39)(H,36,40) |
| InChIKey | GDHPWCCTFAMBBE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|