C34H42N2O6 — CID 3930099
7-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid (PubChem CID 3930099) has the molecular formula C34H42N2O6 and a molecular weight of 574.72 g/mol. Its IUPAC name is 7-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid.
| Compound Name | 7-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 3930099 |
| Molecular Formula | C34H42N2O6 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | 7-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
| SMILES | CC(c1ccccc1)N(C)CC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)CCCCCC(=O)O)cc2)O1 |
| InChI | InChI=1S/C34H42N2O6/c1-24(26-9-5-3-6-10-26)36(2)22-30-21-31(27-15-13-25(23-37)14-16-27)42-34(41-30)28-17-19-29(20-18-28)35-32(38)11-7-4-8-12-33(39)40/h3,5-6,9-10,13-20,24,30-31,34,37H,4,7-8,11-12,21-23H2,1-2H3,(H,35,38)(H,39,40) |
| InChIKey | YHGBAMSVZIYJDT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|