C35H44N2O7 — CID 6678176
7-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid (PubChem CID 6678176) has the molecular formula C35H44N2O7 and a molecular weight of 604.74 g/mol. Its IUPAC name is 7-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid.
| Compound Name | 7-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 6678176 |
| Molecular Formula | C35H44N2O7 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | 7-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)CCCCCC(=O)O)cc2)O1 |
| InChI | InChI=1S/C35H44N2O7/c1-24(34(42)27-9-5-3-6-10-27)37(2)22-30-21-31(26-15-13-25(23-38)14-16-26)44-35(43-30)28-17-19-29(20-18-28)36-32(39)11-7-4-8-12-33(40)41/h3,5-6,9-10,13-20,24,30-31,34-35,38,42H,4,7-8,11-12,21-23H2,1-2H3,(H,36,39)(H,40,41)/t24-,30-,31+,34-,35+/m0/s1 |
| InChIKey | NUGVZBCWIVPFFQ-NTFFGRHCSA-N |
| XLogP | 5.75 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|