C34H42N2O7 — CID 6678161
6-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid (PubChem CID 6678161) has the molecular formula C34H42N2O7 and a molecular weight of 590.72 g/mol. Its IUPAC name is 6-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid.
| Compound Name | 6-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6678161 |
| Molecular Formula | C34H42N2O7 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 6-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)CCCCC(=O)O)c2)O1 |
| InChI | InChI=1S/C34H42N2O7/c1-23(33(41)26-9-4-3-5-10-26)36(2)21-29-20-30(25-17-15-24(22-37)16-18-25)43-34(42-29)27-11-8-12-28(19-27)35-31(38)13-6-7-14-32(39)40/h3-5,8-12,15-19,23,29-30,33-34,37,41H,6-7,13-14,20-22H2,1-2H3,(H,35,38)(H,39,40)/t23-,29-,30+,33-,34+/m0/s1 |
| InChIKey | PKISHUJHRNROAU-ONZJJNNLSA-N |
| XLogP | 5.36 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|