C40H48N4O6 — CID 3446257
N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 3446257) has the molecular formula C40H48N4O6 and a molecular weight of 680.85 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 3446257 |
| Molecular Formula | C40H48N4O6 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | CC(C(O)c1ccccc1)N(C)CC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCC(=O)Nc3ccccc3N)c2)O1 |
| InChI | InChI=1S/C40H48N4O6/c1-27(39(48)30-11-4-3-5-12-30)44(2)25-33-24-36(29-21-19-28(26-45)20-22-29)50-40(49-33)31-13-10-14-32(23-31)42-37(46)17-8-9-18-38(47)43-35-16-7-6-15-34(35)41/h3-7,10-16,19-23,27,33,36,39-40,45,48H,8-9,17-18,24-26,41H2,1-2H3,(H,42,46)(H,43,47) |
| InChIKey | SVZMMHYUIOOCBO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|