C41H50N4O5 — CID 6677305
N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6677305) has the molecular formula C41H50N4O5 and a molecular weight of 678.87 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6677305 |
| Molecular Formula | C41H50N4O5 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.38 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | C[C@@H](c1ccccc1)N(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)CCCCCCC(=O)Nc3ccccc3N)c2)O1 |
| InChI | InChI=1S/C41H50N4O5/c1-29(31-13-6-5-7-14-31)45(2)27-35-26-38(32-23-21-30(28-46)22-24-32)50-41(49-35)33-15-12-16-34(25-33)43-39(47)19-8-3-4-9-20-40(48)44-37-18-11-10-17-36(37)42/h5-7,10-18,21-25,29,35,38,41,46H,3-4,8-9,19-20,26-28,42H2,1-2H3,(H,43,47)(H,44,48)/t29-,35-,38+,41+/m0/s1 |
| InChIKey | LMTUEPKIKYBOLX-GMXJMVNASA-N |
| XLogP | 7.92 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|