C35H44N4O5 — CID 6675862
N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 6675862) has the molecular formula C35H44N4O5 and a molecular weight of 600.76 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 6675862 |
| Molecular Formula | C35H44N4O5 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | C=CCN(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)CCCCCC(=O)Nc3ccccc3N)c2)O1 |
| InChI | InChI=1S/C35H44N4O5/c1-3-20-39(2)23-29-22-32(26-18-16-25(24-40)17-19-26)44-35(43-29)27-10-9-11-28(21-27)37-33(41)14-5-4-6-15-34(42)38-31-13-8-7-12-30(31)36/h3,7-13,16-19,21,29,32,35,40H,1,4-6,14-15,20,22-24,36H2,2H3,(H,37,41)(H,38,42)/t29-,32+,35+/m0/s1 |
| InChIKey | LEBPJXBZBKMKIH-MYWKAQKNSA-N |
| XLogP | 5.95 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|