C42H50N4O5 — CID 6675922
N'-(2-aminophenyl)-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 6675922) has the molecular formula C42H50N4O5 and a molecular weight of 690.88 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6675922 |
| Molecular Formula | C42H50N4O5 |
| Molecular Weight | 690.88 g/mol |
| Exact Mass | 690.38 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | C=CCN(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(-c3cccc(CNC(=O)CCCCCC(=O)Nc4ccccc4N)c3)c2)O1 |
| InChI | InChI=1S/C42H50N4O5/c1-3-23-46(2)28-36-26-39(32-21-19-30(29-47)20-22-32)51-42(50-36)35-14-10-13-34(25-35)33-12-9-11-31(24-33)27-44-40(48)17-5-4-6-18-41(49)45-38-16-8-7-15-37(38)43/h3,7-16,19-22,24-25,36,39,42,47H,1,4-6,17-18,23,26-29,43H2,2H3,(H,44,48)(H,45,49)/t36-,39+,42+/m0/s1 |
| InChIKey | ICGKEYLDEQLMAN-IVTHGCCQSA-N |
| XLogP | 7.30 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.88 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|