C37H46N2O6 — CID 6672323
8-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 6672323) has the molecular formula C37H46N2O6 and a molecular weight of 614.78 g/mol. Its IUPAC name is 8-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6672323 |
| Molecular Formula | C37H46N2O6 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | 8-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | C=CCN(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)CCCCCCC(=O)O)c3)c2)O1 |
| InChI | InChI=1S/C37H46N2O6/c1-3-20-39(2)25-33-23-34(29-18-16-27(26-40)17-19-29)45-37(44-33)32-13-9-12-31(22-32)30-11-8-10-28(21-30)24-38-35(41)14-6-4-5-7-15-36(42)43/h3,8-13,16-19,21-22,33-34,37,40H,1,4-7,14-15,20,23-26H2,2H3,(H,38,41)(H,42,43)/t33-,34+,37+/m1/s1 |
| InChIKey | UFPIJKFPOBYFQN-VXDAHBTDSA-N |
| XLogP | 6.55 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|