C47H68N2O6 — CID 6679373
6-[[3-[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid (PubChem CID 6679373) has the molecular formula C47H68N2O6 and a molecular weight of 757.07 g/mol. Its IUPAC name is 6-[[3-[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid.
| Compound Name | 6-[[3-[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6679373 |
| Molecular Formula | C47H68N2O6 |
| Molecular Weight | 757.07 g/mol |
| Exact Mass | 756.51 |
| IUPAC Name | 6-[[3-[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(-c3cccc(CNC(=O)CCCCC(=O)O)c3)c2)O1 |
| InChI | InChI=1S/C47H68N2O6/c1-3-5-7-9-11-15-29-49(30-16-12-10-8-6-4-2)35-43-33-44(39-27-25-37(36-50)26-28-39)55-47(54-43)42-22-18-21-41(32-42)40-20-17-19-38(31-40)34-48-45(51)23-13-14-24-46(52)53/h17-22,25-28,31-32,43-44,47,50H,3-16,23-24,29-30,33-36H2,1-2H3,(H,48,51)(H,52,53)/t43-,44+,47+/m0/s1 |
| InChIKey | KDWMJOKMXZYVCY-YGPLIJJNSA-N |
| XLogP | 10.68 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.07 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|