C46H67N3O6 — CID 6675771
N-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide (PubChem CID 6675771) has the molecular formula C46H67N3O6 and a molecular weight of 758.06 g/mol. Its IUPAC name is N-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide.
| Compound Name | N-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide |
|---|---|
| PubChem CID | 6675771 |
| Molecular Formula | C46H67N3O6 |
| Molecular Weight | 758.06 g/mol |
| Exact Mass | 757.50 |
| IUPAC Name | N-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)CCCC(=O)NO)c3)c2)O1 |
| InChI | InChI=1S/C46H67N3O6/c1-3-5-7-9-11-13-28-49(29-14-12-10-8-6-4-2)34-42-32-43(38-26-24-36(35-50)25-27-38)55-46(54-42)41-21-16-20-40(31-41)39-19-15-18-37(30-39)33-47-44(51)22-17-23-45(52)48-53/h15-16,18-21,24-27,30-31,42-43,46,50,53H,3-14,17,22-23,28-29,32-35H2,1-2H3,(H,47,51)(H,48,52)/t42-,43+,46+/m1/s1 |
| InChIKey | NFBJDJDTXJMNPE-IQXPGNSMSA-N |
| XLogP | 9.71 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.06 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|