C47H53N3O6 — CID 4306257
N-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide (PubChem CID 4306257) has the molecular formula C47H53N3O6 and a molecular weight of 755.96 g/mol. Its IUPAC name is N-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 4306257 |
| Molecular Formula | C47H53N3O6 |
| Molecular Weight | 755.96 g/mol |
| Exact Mass | 755.39 |
| IUPAC Name | N-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1cccc(-c2cccc(C3OC(CN(Cc4ccccc4)Cc4ccccc4)CC(c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C47H53N3O6/c51-34-37-23-25-39(26-24-37)44-29-43(33-50(31-35-13-5-3-6-14-35)32-36-15-7-4-8-16-36)55-47(56-44)42-20-12-19-41(28-42)40-18-11-17-38(27-40)30-48-45(52)21-9-1-2-10-22-46(53)49-54/h3-8,11-20,23-28,43-44,47,51,54H,1-2,9-10,21-22,29-34H2,(H,48,52)(H,49,53) |
| InChIKey | MYIRCNMCOLSHHI-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.96 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|