C45H48N2O6 — CID 3973113
6-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid (PubChem CID 3973113) has the molecular formula C45H48N2O6 and a molecular weight of 712.89 g/mol. Its IUPAC name is 6-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid.
| Compound Name | 6-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 3973113 |
| Molecular Formula | C45H48N2O6 |
| Molecular Weight | 712.89 g/mol |
| Exact Mass | 712.35 |
| IUPAC Name | 6-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)NCc1cccc(-c2cccc(C3OC(CN(Cc4ccccc4)Cc4ccccc4)CC(c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C45H48N2O6/c48-32-35-21-23-37(24-22-35)42-27-41(31-47(29-33-11-3-1-4-12-33)30-34-13-5-2-6-14-34)52-45(53-42)40-18-10-17-39(26-40)38-16-9-15-36(25-38)28-46-43(49)19-7-8-20-44(50)51/h1-6,9-18,21-26,41-42,45,48H,7-8,19-20,27-32H2,(H,46,49)(H,50,51) |
| InChIKey | AKRYPLYXGQJRFJ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.89 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|