C52H56N4O5 — CID 3974116
N'-(2-aminophenyl)-N-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 3974116) has the molecular formula C52H56N4O5 and a molecular weight of 817.04 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 3974116 |
| Molecular Formula | C52H56N4O5 |
| Molecular Weight | 817.04 g/mol |
| Exact Mass | 816.43 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1cccc(-c2cccc(C3OC(CN(Cc4ccccc4)Cc4ccccc4)CC(c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C52H56N4O5/c53-47-22-10-11-23-48(47)55-51(59)25-9-3-8-24-50(58)54-33-41-18-12-19-43(30-41)44-20-13-21-45(31-44)52-60-46(32-49(61-52)42-28-26-40(37-57)27-29-42)36-56(34-38-14-4-1-5-15-38)35-39-16-6-2-7-17-39/h1-2,4-7,10-23,26-31,46,49,52,57H,3,8-9,24-25,32-37,53H2,(H,54,58)(H,55,59) |
| InChIKey | FSYKVQIBUMVSCQ-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.04 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|