C46H52N4O5 — CID 4006918
N'-(2-aminophenyl)-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 4006918) has the molecular formula C46H52N4O5 and a molecular weight of 740.94 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 4006918 |
| Molecular Formula | C46H52N4O5 |
| Molecular Weight | 740.94 g/mol |
| Exact Mass | 740.39 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | CC(c1ccccc1)N(C)CC1CC(c2ccc(CO)cc2)OC(c2cccc(-c3cccc(CNC(=O)CCCCC(=O)Nc4ccccc4N)c3)c2)O1 |
| InChI | InChI=1S/C46H52N4O5/c1-32(35-13-4-3-5-14-35)50(2)30-40-28-43(36-24-22-33(31-51)23-25-36)55-46(54-40)39-17-11-16-38(27-39)37-15-10-12-34(26-37)29-48-44(52)20-8-9-21-45(53)49-42-19-7-6-18-41(42)47/h3-7,10-19,22-27,32,40,43,46,51H,8-9,20-21,28-31,47H2,1-2H3,(H,48,52)(H,49,53) |
| InChIKey | CSOLJZNEIYTLQK-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.94 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|