C39H46N4O5 — CID 6673711
N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6673711) has the molecular formula C39H46N4O5 and a molecular weight of 650.82 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6673711 |
| Molecular Formula | C39H46N4O5 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | C[C@@H](c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)CCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C39H46N4O5/c1-27(29-10-4-3-5-11-29)43(2)25-33-24-36(30-18-16-28(26-44)17-19-30)48-39(47-33)31-20-22-32(23-21-31)41-37(45)14-8-9-15-38(46)42-35-13-7-6-12-34(35)40/h3-7,10-13,16-23,27,33,36,39,44H,8-9,14-15,24-26,40H2,1-2H3,(H,41,45)(H,42,46)/t27-,33+,36-,39-/m0/s1 |
| InChIKey | FKIZAJRURGOBHE-ZGHRKNPHSA-N |
| XLogP | 7.14 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|