C40H48N4O5 — CID 6677029
N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6677029) has the molecular formula C40H48N4O5 and a molecular weight of 664.85 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6677029 |
| Molecular Formula | C40H48N4O5 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.36 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | CN(Cc1ccccc1)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)CCCCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C40H48N4O5/c1-44(26-29-11-5-4-6-12-29)27-34-25-37(31-19-17-30(28-45)18-20-31)49-40(48-34)32-21-23-33(24-22-32)42-38(46)15-7-2-3-8-16-39(47)43-36-14-10-9-13-35(36)41/h4-6,9-14,17-24,34,37,40,45H,2-3,7-8,15-16,25-28,41H2,1H3,(H,42,46)(H,43,47)/t34-,37+,40+/m0/s1 |
| InChIKey | VILIAPNXVLCNCF-SQPBBZFASA-N |
| XLogP | 7.36 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|