C39H50N4O5 — CID 6673498
N'-(2-aminophenyl)-N-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 6673498) has the molecular formula C39H50N4O5 and a molecular weight of 654.85 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 6673498 |
| Molecular Formula | C39H50N4O5 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.38 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | C=CCN(C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)CCCCCC(=O)Nc3ccccc3N)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C39H50N4O5/c1-2-24-43(32-10-6-7-11-32)26-33-25-36(29-18-16-28(27-44)17-19-29)48-39(47-33)30-20-22-31(23-21-30)41-37(45)14-4-3-5-15-38(46)42-35-13-9-8-12-34(35)40/h2,8-9,12-13,16-23,32-33,36,39,44H,1,3-7,10-11,14-15,24-27,40H2,(H,41,45)(H,42,46)/t33-,36+,39+/m1/s1 |
| InChIKey | CQZRYOYEWJMXES-OVDDFZKSSA-N |
| XLogP | 7.26 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|