C32H43N3O6 — CID 3918787
N-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide (PubChem CID 3918787) has the molecular formula C32H43N3O6 and a molecular weight of 565.71 g/mol. Its IUPAC name is N-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 3918787 |
| Molecular Formula | C32H43N3O6 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | N-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide |
| SMILES | C=CCN(CC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)CCCCC(=O)NO)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C32H43N3O6/c1-2-19-35(27-7-3-4-8-27)21-28-20-29(24-13-11-23(22-36)12-14-24)41-32(40-28)25-15-17-26(18-16-25)33-30(37)9-5-6-10-31(38)34-39/h2,11-18,27-29,32,36,39H,1,3-10,19-22H2,(H,33,37)(H,34,38) |
| InChIKey | KQOJDVUKXBBUFW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|