C40H51N3O6 — CID 4017516
N-[[2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide (PubChem CID 4017516) has the molecular formula C40H51N3O6 and a molecular weight of 669.86 g/mol. Its IUPAC name is N-[[2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[[2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 4017516 |
| Molecular Formula | C40H51N3O6 |
| Molecular Weight | 669.86 g/mol |
| Exact Mass | 669.38 |
| IUPAC Name | N-[[2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide |
| SMILES | C=CCN(CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3ccccc3CNC(=O)CCCCCC(=O)NO)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C40H51N3O6/c1-2-24-43(34-11-7-8-12-34)27-35-25-37(31-18-16-29(28-44)17-19-31)49-40(48-35)32-22-20-30(21-23-32)36-13-9-6-10-33(36)26-41-38(45)14-4-3-5-15-39(46)42-47/h2,6,9-10,13,16-23,34-35,37,40,44,47H,1,3-5,7-8,11-12,14-15,24-28H2,(H,41,45)(H,42,46) |
| InChIKey | MQVIHTBACXNECM-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.86 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|