C41H49N3O6 — CID 6673749
N'-hydroxy-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 6673749) has the molecular formula C41H49N3O6 and a molecular weight of 679.86 g/mol. Its IUPAC name is N'-hydroxy-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6673749 |
| Molecular Formula | C41H49N3O6 |
| Molecular Weight | 679.86 g/mol |
| Exact Mass | 679.36 |
| IUPAC Name | N'-hydroxy-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | C[C@@H](c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)CCCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C41H49N3O6/c1-29(31-11-5-3-6-12-31)44(2)27-36-25-38(33-19-17-30(28-45)18-20-33)50-41(49-36)34-23-21-32(22-24-34)37-14-10-9-13-35(37)26-42-39(46)15-7-4-8-16-40(47)43-48/h3,5-6,9-14,17-24,29,36,38,41,45,48H,4,7-8,15-16,25-28H2,1-2H3,(H,42,46)(H,43,47)/t29-,36+,38-,41-/m0/s1 |
| InChIKey | IHTGKEQMCHZUSP-QXSVUYLRSA-N |
| XLogP | 7.16 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.86 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|