C40H47N3O6 — CID 5011263
N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 5011263) has the molecular formula C40H47N3O6 and a molecular weight of 665.83 g/mol. Its IUPAC name is N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 5011263 |
| Molecular Formula | C40H47N3O6 |
| Molecular Weight | 665.83 g/mol |
| Exact Mass | 665.35 |
| IUPAC Name | N'-hydroxy-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(1-phenylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | CC(c1ccccc1)N(C)CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3ccccc3CNC(=O)CCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C40H47N3O6/c1-28(30-10-4-3-5-11-30)43(2)26-35-24-37(32-18-16-29(27-44)17-19-32)49-40(48-35)33-22-20-31(21-23-33)36-13-7-6-12-34(36)25-41-38(45)14-8-9-15-39(46)42-47/h3-7,10-13,16-23,28,35,37,40,44,47H,8-9,14-15,24-27H2,1-2H3,(H,41,45)(H,42,46) |
| InChIKey | AQRJJKUEKWIMGC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.83 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|