C34H43N3O6 — CID 6673713
N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 6673713) has the molecular formula C34H43N3O6 and a molecular weight of 589.73 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 6673713 |
| Molecular Formula | C34H43N3O6 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | C[C@@H](c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)CCCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C34H43N3O6/c1-24(26-9-5-3-6-10-26)37(2)22-30-21-31(27-15-13-25(23-38)14-16-27)43-34(42-30)28-17-19-29(20-18-28)35-32(39)11-7-4-8-12-33(40)36-41/h3,5-6,9-10,13-20,24,30-31,34,38,41H,4,7-8,11-12,21-23H2,1-2H3,(H,35,39)(H,36,40)/t24-,30+,31-,34-/m0/s1 |
| InChIKey | CNMXJVJVXFNRRU-HOOQMPIRSA-N |
| XLogP | 5.81 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|