C33H41N3O7 — CID 6674499
N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide (PubChem CID 6674499) has the molecular formula C33H41N3O7 and a molecular weight of 591.71 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide.
| Compound Name | N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 6674499 |
| Molecular Formula | C33H41N3O7 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)CCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C33H41N3O7/c1-22(32(40)25-7-4-3-5-8-25)36(2)20-28-19-29(24-13-11-23(21-37)12-14-24)43-33(42-28)26-15-17-27(18-16-26)34-30(38)9-6-10-31(39)35-41/h3-5,7-8,11-18,22,28-29,32-33,37,40-41H,6,9-10,19-21H2,1-2H3,(H,34,38)(H,35,39)/t22-,28-,29+,32-,33+/m1/s1 |
| InChIKey | WGPFXTWBMMCOLD-SXEGYIPQSA-N |
| XLogP | 4.39 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|