C33H40N2O7 — CID 6678158
5-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid (PubChem CID 6678158) has the molecular formula C33H40N2O7 and a molecular weight of 576.69 g/mol. Its IUPAC name is 5-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6678158 |
| Molecular Formula | C33H40N2O7 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | 5-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)CCCC(=O)O)c2)O1 |
| InChI | InChI=1S/C33H40N2O7/c1-22(32(40)25-8-4-3-5-9-25)35(2)20-28-19-29(24-16-14-23(21-36)15-17-24)42-33(41-28)26-10-6-11-27(18-26)34-30(37)12-7-13-31(38)39/h3-6,8-11,14-18,22,28-29,32-33,36,40H,7,12-13,19-21H2,1-2H3,(H,34,37)(H,38,39)/t22-,28-,29+,32-,33+/m0/s1 |
| InChIKey | JGGHQNXCFPFMTH-AWFUGDEDSA-N |
| XLogP | 4.97 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |