C30H33Cl3N2O5 — CID 6701918
2,2,2-trichloro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6701918) has the molecular formula C30H33Cl3N2O5 and a molecular weight of 607.96 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6701918 |
| Molecular Formula | C30H33Cl3N2O5 |
| Molecular Weight | 607.96 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)C(Cl)(Cl)Cl)c2)O1 |
| InChI | InChI=1S/C30H33Cl3N2O5/c1-19(27(37)22-7-4-3-5-8-22)35(2)17-25-16-26(21-13-11-20(18-36)12-14-21)40-28(39-25)23-9-6-10-24(15-23)34-29(38)30(31,32)33/h3-15,19,25-28,36-37H,16-18H2,1-2H3,(H,34,38)/t19-,25-,26+,27-,28+/m1/s1 |
| InChIKey | YXGXAWJNOIRKDK-DZQXLJNESA-N |
| XLogP | 6.09 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.96 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|