C37H38N4O5 — CID 6701925
N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide (PubChem CID 6701925) has the molecular formula C37H38N4O5 and a molecular weight of 618.73 g/mol. Its IUPAC name is N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6701925 |
| Molecular Formula | C37H38N4O5 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)c3cnc4ccccc4n3)c2)O1 |
| InChI | InChI=1S/C37H38N4O5/c1-24(35(43)27-9-4-3-5-10-27)41(2)22-30-20-34(26-17-15-25(23-42)16-18-26)46-37(45-30)28-11-8-12-29(19-28)39-36(44)33-21-38-31-13-6-7-14-32(31)40-33/h3-19,21,24,30,34-35,37,42-43H,20,22-23H2,1-2H3,(H,39,44)/t24-,30-,34+,35-,37+/m1/s1 |
| InChIKey | JAVJQGNSGQSDRC-SLBWLRFZSA-N |
| XLogP | 5.97 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |