C31H39N3O5 — CID 6702042
1-ethyl-3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6702042) has the molecular formula C31H39N3O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is 1-ethyl-3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-ethyl-3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6702042 |
| Molecular Formula | C31H39N3O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | 1-ethyl-3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | CCNC(=O)Nc1cccc([C@H]2O[C@@H](CN(C)[C@@H](C)[C@H](O)c3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C31H39N3O5/c1-4-32-31(37)33-26-12-8-11-25(17-26)30-38-27(18-28(39-30)23-15-13-22(20-35)14-16-23)19-34(3)21(2)29(36)24-9-6-5-7-10-24/h5-17,21,27-30,35-36H,4,18-20H2,1-3H3,(H2,32,33,37)/t21-,27+,28-,29-,30-/m0/s1 |
| InChIKey | JJJMZIBPANZKIL-YMSVTYLOSA-N |
| XLogP | 4.92 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |