C35H33F5N2O5 — CID 6701922
2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6701922) has the molecular formula C35H33F5N2O5 and a molecular weight of 656.65 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6701922 |
| Molecular Formula | C35H33F5N2O5 |
| Molecular Weight | 656.65 g/mol |
| Exact Mass | 656.23 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)c2)O1 |
| InChI | InChI=1S/C35H33F5N2O5/c1-19(33(44)22-7-4-3-5-8-22)42(2)17-25-16-26(21-13-11-20(18-43)12-14-21)47-35(46-25)23-9-6-10-24(15-23)41-34(45)27-28(36)30(38)32(40)31(39)29(27)37/h3-15,19,25-26,33,35,43-44H,16-18H2,1-2H3,(H,41,45)/t19-,25-,26+,33-,35+/m1/s1 |
| InChIKey | MRMCBHNZXREWPN-ZOLGAHEZSA-N |
| XLogP | 6.73 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|