C35H45N3O7 — CID 3539068
N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 3539068) has the molecular formula C35H45N3O7 and a molecular weight of 619.76 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 3539068 |
| Molecular Formula | C35H45N3O7 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | N'-hydroxy-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | CC(C(O)c1ccccc1)N(C)CC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCCC(=O)NO)c2)O1 |
| InChI | InChI=1S/C35H45N3O7/c1-24(34(42)27-10-5-3-6-11-27)38(2)22-30-21-31(26-18-16-25(23-39)17-19-26)45-35(44-30)28-12-9-13-29(20-28)36-32(40)14-7-4-8-15-33(41)37-43/h3,5-6,9-13,16-20,24,30-31,34-35,39,42-43H,4,7-8,14-15,21-23H2,1-2H3,(H,36,40)(H,37,41) |
| InChIKey | CFMIVVIKAKXULI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|