C43H58N4O4 — CID 6698299
N-[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide (PubChem CID 6698299) has the molecular formula C43H58N4O4 and a molecular weight of 694.96 g/mol. Its IUPAC name is N-[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6698299 |
| Molecular Formula | C43H58N4O4 |
| Molecular Weight | 694.96 g/mol |
| Exact Mass | 694.45 |
| IUPAC Name | N-[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)c3cnc4ccccc4n3)c2)O1 |
| InChI | InChI=1S/C43H58N4O4/c1-3-5-7-9-11-15-26-47(27-16-12-10-8-6-4-2)31-37-29-41(34-24-22-33(32-48)23-25-34)51-43(50-37)35-18-17-19-36(28-35)45-42(49)40-30-44-38-20-13-14-21-39(38)46-40/h13-14,17-25,28,30,37,41,43,48H,3-12,15-16,26-27,29,31-32H2,1-2H3,(H,45,49)/t37-,41+,43+/m0/s1 |
| InChIKey | SZKJXKMXAMSWEE-PDUKUSGRSA-N |
| XLogP | 9.94 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.96 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|