C41H64N2O6 — CID 3287380
7-[3-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid (PubChem CID 3287380) has the molecular formula C41H64N2O6 and a molecular weight of 680.97 g/mol. Its IUPAC name is 7-[3-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid.
| Compound Name | 7-[3-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 3287380 |
| Molecular Formula | C41H64N2O6 |
| Molecular Weight | 680.97 g/mol |
| Exact Mass | 680.48 |
| IUPAC Name | 7-[3-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCCC(=O)O)c2)O1 |
| InChI | InChI=1S/C41H64N2O6/c1-3-5-7-9-11-16-27-43(28-17-12-10-8-6-4-2)31-37-30-38(34-25-23-33(32-44)24-26-34)49-41(48-37)35-19-18-20-36(29-35)42-39(45)21-14-13-15-22-40(46)47/h18-20,23-26,29,37-38,41,44H,3-17,21-22,27-28,30-32H2,1-2H3,(H,42,45)(H,46,47) |
| InChIKey | ZFLYMVZTERBFLF-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.97 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|