C42H67N3O5 — CID 6707228
6-acetamido-N-[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanamide (PubChem CID 6707228) has the molecular formula C42H67N3O5 and a molecular weight of 694.01 g/mol. Its IUPAC name is 6-acetamido-N-[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanamide.
| Compound Name | 6-acetamido-N-[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 6707228 |
| Molecular Formula | C42H67N3O5 |
| Molecular Weight | 694.01 g/mol |
| Exact Mass | 693.51 |
| IUPAC Name | 6-acetamido-N-[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)CCCCCNC(C)=O)cc2)O1 |
| InChI | InChI=1S/C42H67N3O5/c1-4-6-8-10-12-17-29-45(30-18-13-11-9-7-5-2)32-39-31-40(36-22-20-35(33-46)21-23-36)50-42(49-39)37-24-26-38(27-25-37)44-41(48)19-15-14-16-28-43-34(3)47/h20-27,39-40,42,46H,4-19,28-33H2,1-3H3,(H,43,47)(H,44,48)/t39-,40+,42+/m0/s1 |
| InChIKey | YIXQGMDBJBYJAY-MQFHWOLUSA-N |
| XLogP | 9.38 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.01 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|