C48H72N4O5 — CID 3940468
N'-(2-aminophenyl)-N-[[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide (PubChem CID 3940468) has the molecular formula C48H72N4O5 and a molecular weight of 785.13 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 3940468 |
| Molecular Formula | C48H72N4O5 |
| Molecular Weight | 785.13 g/mol |
| Exact Mass | 784.55 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1CC(c2ccc(CO)cc2)OC(c2ccc(CNC(=O)CCCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C48H72N4O5/c1-3-5-7-9-11-18-32-52(33-19-12-10-8-6-4-2)36-42-34-45(40-28-26-39(37-53)27-29-40)57-48(56-42)41-30-24-38(25-31-41)35-50-46(54)22-14-13-15-23-47(55)51-44-21-17-16-20-43(44)49/h16-17,20-21,24-31,42,45,48,53H,3-15,18-19,22-23,32-37,49H2,1-2H3,(H,50,54)(H,51,55) |
| InChIKey | XGUKPFRXWHJGOD-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.13 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|