C43H68N2O6 — CID 6679343
8-[[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 6679343) has the molecular formula C43H68N2O6 and a molecular weight of 709.02 g/mol. Its IUPAC name is 8-[[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6679343 |
| Molecular Formula | C43H68N2O6 |
| Molecular Weight | 709.02 g/mol |
| Exact Mass | 708.51 |
| IUPAC Name | 8-[[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)CCCCCCC(=O)O)cc2)O1 |
| InChI | InChI=1S/C43H68N2O6/c1-3-5-7-9-13-17-29-45(30-18-14-10-8-6-4-2)33-39-31-40(37-25-23-36(34-46)24-26-37)51-43(50-39)38-27-21-35(22-28-38)32-44-41(47)19-15-11-12-16-20-42(48)49/h21-28,39-40,43,46H,3-20,29-34H2,1-2H3,(H,44,47)(H,48,49)/t39-,40+,43+/m0/s1 |
| InChIKey | GPUJMTCIBUNJIX-ZBQYUAFOSA-N |
| XLogP | 9.79 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.02 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|