C42H67N3O6 — CID 3327241
N-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyoctanediamide (PubChem CID 3327241) has the molecular formula C42H67N3O6 and a molecular weight of 710.01 g/mol. Its IUPAC name is N-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 3327241 |
| Molecular Formula | C42H67N3O6 |
| Molecular Weight | 710.01 g/mol |
| Exact Mass | 709.50 |
| IUPAC Name | N-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyoctanediamide |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)CCCCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C42H67N3O6/c1-3-5-7-9-13-17-29-45(30-18-14-10-8-6-4-2)32-38-31-39(35-23-21-34(33-46)22-24-35)51-42(50-38)36-25-27-37(28-26-36)43-40(47)19-15-11-12-16-20-41(48)44-49/h21-28,38-39,42,46,49H,3-20,29-33H2,1-2H3,(H,43,47)(H,44,48) |
| InChIKey | PRZWSNMEFXSRSU-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.01 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|