C37H59N3O4 — CID 6708278
1-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-3-ethylurea (PubChem CID 6708278) has the molecular formula C37H59N3O4 and a molecular weight of 609.90 g/mol. Its IUPAC name is 1-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-3-ethylurea.
| Compound Name | 1-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 6708278 |
| Molecular Formula | C37H59N3O4 |
| Molecular Weight | 609.90 g/mol |
| Exact Mass | 609.45 |
| IUPAC Name | 1-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)NCC)cc2)O1 |
| InChI | InChI=1S/C37H59N3O4/c1-4-7-9-11-13-15-25-40(26-16-14-12-10-8-5-2)28-34-27-35(31-19-17-30(29-41)18-20-31)44-36(43-34)32-21-23-33(24-22-32)39-37(42)38-6-3/h17-24,34-36,41H,4-16,25-29H2,1-3H3,(H2,38,39,42)/t34-,35+,36+/m1/s1 |
| InChIKey | ORTKELXBZBHBOL-SBPNQFBHSA-N |
| XLogP | 8.89 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.90 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|