C44H65N3O4 — CID 6703846
1-[[3-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-ethylurea (PubChem CID 6703846) has the molecular formula C44H65N3O4 and a molecular weight of 700.02 g/mol. Its IUPAC name is 1-[[3-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-ethylurea.
| Compound Name | 1-[[3-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-ethylurea |
|---|---|
| PubChem CID | 6703846 |
| Molecular Formula | C44H65N3O4 |
| Molecular Weight | 700.02 g/mol |
| Exact Mass | 699.50 |
| IUPAC Name | 1-[[3-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-ethylurea |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3cccc(CNC(=O)NCC)c3)cc2)O1 |
| InChI | InChI=1S/C44H65N3O4/c1-4-7-9-11-13-15-28-47(29-16-14-12-10-8-5-2)33-41-31-42(38-22-20-35(34-48)21-23-38)51-43(50-41)39-26-24-37(25-27-39)40-19-17-18-36(30-40)32-46-44(49)45-6-3/h17-27,30,41-43,48H,4-16,28-29,31-34H2,1-3H3,(H2,45,46,49)/t41-,42+,43+/m1/s1 |
| InChIKey | SAFIWRDOTKCQFR-PYHIYFCPSA-N |
| XLogP | 10.23 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.02 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|