C45H67N3O4 — CID 3542958
1-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-ethylurea (PubChem CID 3542958) has the molecular formula C45H67N3O4 and a molecular weight of 714.05 g/mol. Its IUPAC name is 1-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-ethylurea.
| Compound Name | 1-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-ethylurea |
|---|---|
| PubChem CID | 3542958 |
| Molecular Formula | C45H67N3O4 |
| Molecular Weight | 714.05 g/mol |
| Exact Mass | 713.51 |
| IUPAC Name | 1-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-ethylurea |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1OC(c2ccc(-c3cccc(CNC(=O)NCC)c3)cc2)OC(c2ccc(CO)cc2)C1C |
| InChI | InChI=1S/C45H67N3O4/c1-5-8-10-12-14-16-29-48(30-17-15-13-11-9-6-2)33-42-35(4)43(39-23-21-36(34-49)22-24-39)52-44(51-42)40-27-25-38(26-28-40)41-20-18-19-37(31-41)32-47-45(50)46-7-3/h18-28,31,35,42-44,49H,5-17,29-30,32-34H2,1-4H3,(H2,46,47,50) |
| InChIKey | IKLXHZXOXYUJGJ-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.05 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|