C50H64N2O5 — CID 6692843
2-[[3-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6692843) has the molecular formula C50H64N2O5 and a molecular weight of 773.07 g/mol. Its IUPAC name is 2-[[3-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6692843 |
| Molecular Formula | C50H64N2O5 |
| Molecular Weight | 773.07 g/mol |
| Exact Mass | 772.48 |
| IUPAC Name | 2-[[3-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1O[C@H](c2ccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)cc2)O[C@H](c2ccc(CO)cc2)[C@@H]1C |
| InChI | InChI=1S/C50H64N2O5/c1-4-6-8-10-12-16-31-51(32-17-13-11-9-7-5-2)35-46-37(3)47(41-25-23-38(36-53)24-26-41)57-50(56-46)42-29-27-40(28-30-42)43-20-18-19-39(33-43)34-52-48(54)44-21-14-15-22-45(44)49(52)55/h14-15,18-30,33,37,46-47,50,53H,4-13,16-17,31-32,34-36H2,1-3H3/t37-,46+,47+,50+/m1/s1 |
| InChIKey | WGDWZRPLCKEHJU-ROGLNXBISA-N |
| XLogP | 11.46 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.07 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|