C42H44N2O5 — CID 6683535
2-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6683535) has the molecular formula C42H44N2O5 and a molecular weight of 656.82 g/mol. Its IUPAC name is 2-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6683535 |
| Molecular Formula | C42H44N2O5 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.33 |
| IUPAC Name | 2-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C=CCN(C[C@H]1O[C@@H](c2ccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)cc2)O[C@@H](c2ccc(CO)cc2)[C@H]1C)C1CCCC1 |
| InChI | InChI=1S/C42H44N2O5/c1-3-23-43(35-11-4-5-12-35)26-38-28(2)39(32-17-15-29(27-45)16-18-32)49-42(48-38)33-21-19-31(20-22-33)34-10-8-9-30(24-34)25-44-40(46)36-13-6-7-14-37(36)41(44)47/h3,6-10,13-22,24,28,35,38-39,42,45H,1,4-5,11-12,23,25-27H2,2H3/t28-,38+,39+,42+/m0/s1 |
| InChIKey | XKVNOAFBWKIDSS-DVRNBNHCSA-N |
| XLogP | 7.86 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|