C39H48N2O6 — CID 6683525
[(2S)-1-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate (PubChem CID 6683525) has the molecular formula C39H48N2O6 and a molecular weight of 640.82 g/mol. Its IUPAC name is [(2S)-1-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate.
| Compound Name | [(2S)-1-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 6683525 |
| Molecular Formula | C39H48N2O6 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | [(2S)-1-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate |
| SMILES | C=CCN(C[C@H]1O[C@@H](c2ccc(-c3cccc(CNC(=O)[C@H](C)OC(C)=O)c3)cc2)OC(c2ccc(CO)cc2)[C@H]1C)C1CCCC1 |
| InChI | InChI=1S/C39H48N2O6/c1-5-21-41(35-11-6-7-12-35)24-36-26(2)37(32-15-13-29(25-42)14-16-32)47-39(46-36)33-19-17-31(18-20-33)34-10-8-9-30(22-34)23-40-38(44)27(3)45-28(4)43/h5,8-10,13-20,22,26-27,35-37,39,42H,1,6-7,11-12,21,23-25H2,2-4H3,(H,40,44)/t26-,27-,36+,37?,39+/m0/s1 |
| InChIKey | NHXWDMJLYRGJQA-HRIBEEFFSA-N |
| XLogP | 6.64 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|