C36H44N2O4 — CID 6689299
N-[[2-[4-[(2R,4R,5S,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6689299) has the molecular formula C36H44N2O4 and a molecular weight of 568.76 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4R,5S,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[[2-[4-[(2R,4R,5S,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6689299 |
| Molecular Formula | C36H44N2O4 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | N-[[2-[4-[(2R,4R,5S,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | C=CCN(C[C@@H]1O[C@H](c2ccc(-c3ccccc3CNC(C)=O)cc2)OC(c2ccc(CO)cc2)[C@@H]1C)C1CCCC1 |
| InChI | InChI=1S/C36H44N2O4/c1-4-21-38(32-10-6-7-11-32)23-34-25(2)35(29-15-13-27(24-39)14-16-29)42-36(41-34)30-19-17-28(18-20-30)33-12-8-5-9-31(33)22-37-26(3)40/h4-5,8-9,12-20,25,32,34-36,39H,1,6-7,10-11,21-24H2,2-3H3,(H,37,40)/t25-,34+,35?,36+/m1/s1 |
| InChIKey | YSCFOKDHEIBSSQ-DDKYNBMUSA-N |
| XLogP | 6.70 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|