C41H46N2O4 — CID 6683524
N-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6683524) has the molecular formula C41H46N2O4 and a molecular weight of 630.83 g/mol. Its IUPAC name is N-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6683524 |
| Molecular Formula | C41H46N2O4 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | N-[[3-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | C=CCN(C[C@H]1O[C@@H](c2ccc(-c3cccc(CNC(=O)c4ccccc4)c3)cc2)OC(c2ccc(CO)cc2)[C@H]1C)C1CCCC1 |
| InChI | InChI=1S/C41H46N2O4/c1-3-24-43(37-14-7-8-15-37)27-38-29(2)39(33-18-16-30(28-44)17-19-33)47-41(46-38)35-22-20-32(21-23-35)36-13-9-10-31(25-36)26-42-40(45)34-11-5-4-6-12-34/h3-6,9-13,16-23,25,29,37-39,41,44H,1,7-8,14-15,24,26-28H2,2H3,(H,42,45)/t29-,38+,39?,41+/m0/s1 |
| InChIKey | PEZBHXMKINZTCV-AOOJVOPASA-N |
| XLogP | 8.00 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|