C38H46N2O5 — CID 6689312
prop-2-enyl N-[[3-[3-[(2R,4R,5S,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate (PubChem CID 6689312) has the molecular formula C38H46N2O5 and a molecular weight of 610.79 g/mol. Its IUPAC name is prop-2-enyl N-[[3-[3-[(2R,4R,5S,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[3-[3-[(2R,4R,5S,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 6689312 |
| Molecular Formula | C38H46N2O5 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | prop-2-enyl N-[[3-[3-[(2R,4R,5S,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1cccc(-c2cccc([C@@H]3OC(c4ccc(CO)cc4)[C@H](C)[C@H](CN(CC=C)C4CCCC4)O3)c2)c1 |
| InChI | InChI=1S/C38H46N2O5/c1-4-20-40(34-14-6-7-15-34)25-35-27(3)36(30-18-16-28(26-41)17-19-30)45-37(44-35)33-13-9-12-32(23-33)31-11-8-10-29(22-31)24-39-38(42)43-21-5-2/h4-5,8-13,16-19,22-23,27,34-37,41H,1-2,6-7,14-15,20-21,24-26H2,3H3,(H,39,42)/t27-,35+,36?,37+/m1/s1 |
| InChIKey | WUGLLXJFLALLTR-CYQMTUHFSA-N |
| XLogP | 7.48 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|