C33H41N3O4 — CID 6681632
1-ethyl-3-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6681632) has the molecular formula C33H41N3O4 and a molecular weight of 543.71 g/mol. Its IUPAC name is 1-ethyl-3-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6681632 |
| Molecular Formula | C33H41N3O4 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | 1-ethyl-3-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C=CCN(C)C[C@H]1O[C@@H](c2cccc(-c3cccc(CNC(=O)NCC)c3)c2)OC(c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C33H41N3O4/c1-5-17-36(4)21-30-23(3)31(26-15-13-24(22-37)14-16-26)40-32(39-30)29-12-8-11-28(19-29)27-10-7-9-25(18-27)20-35-33(38)34-6-2/h5,7-16,18-19,23,30-32,37H,1,6,17,20-22H2,2-4H3,(H2,34,35,38)/t23-,30+,31?,32+/m0/s1 |
| InChIKey | ZMKAWVAMGQTSPL-CBNIBAFZSA-N |
| XLogP | 5.57 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|