C37H44N4O4 — CID 6684159
1-ethyl-3-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6684159) has the molecular formula C37H44N4O4 and a molecular weight of 608.78 g/mol. Its IUPAC name is 1-ethyl-3-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6684159 |
| Molecular Formula | C37H44N4O4 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.34 |
| IUPAC Name | 1-ethyl-3-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | CCNC(=O)NCc1cccc(-c2cccc([C@H]3OC(c4ccc(CO)cc4)[C@@H](C)[C@@H](CN(C)CCc4ccccn4)O3)c2)c1 |
| InChI | InChI=1S/C37H44N4O4/c1-4-38-37(43)40-23-28-9-7-10-30(21-28)31-11-8-12-32(22-31)36-44-34(24-41(3)20-18-33-13-5-6-19-39-33)26(2)35(45-36)29-16-14-27(25-42)15-17-29/h5-17,19,21-22,26,34-36,42H,4,18,20,23-25H2,1-3H3,(H2,38,40,43)/t26-,34+,35?,36+/m0/s1 |
| InChIKey | VVOMFJBALLBCLD-VJMHIDEBSA-N |
| XLogP | 6.03 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |